C12H17N3O3S — CID 16949277
S-[2-[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)amino]-2-oxoethyl] ethanethioate (PubChem CID 16949277) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is S-[2-[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)amino]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)amino]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 16949277 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | S-[2-[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)amino]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)Nc1nnc(C2CCCCC2)o1 |
| InChI | InChI=1S/C12H17N3O3S/c1-8(16)19-7-10(17)13-12-15-14-11(18-12)9-5-3-2-4-6-9/h9H,2-7H2,1H3,(H,13,15,17) |
| InChIKey | SAHJVWQTHXTVKO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|