About N-(2-cyanopropyl)nitrous amide
N-(2-cyanopropyl)nitrous amide (PubChem CID 169495087) has the molecular formula C4H7N3O
and a molecular weight of 113.12 g/mol. Its IUPAC name is N-(2-cyanopropyl)nitrous amide.
Molecular Properties
| Compound Name | N-(2-cyanopropyl)nitrous amide |
| PubChem CID | 169495087 |
| Molecular Formula | C4H7N3O |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | N-(2-cyanopropyl)nitrous amide |
| SMILES | CC(C#N)CNN=O |
| InChI | InChI=1S/C4H7N3O/c1-4(2-5)3-6-7-8/h4H,3H2,1H3,(H,6,8) |
| InChIKey | HUHZVEQFNQEAKG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-cyanopropyl)nitrous amide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanopropyl)nitrous amide?
The IUPAC name of N-(2-cyanopropyl)nitrous amide (CID 169495087) is N-(2-cyanopropyl)nitrous amide.
What is the SMILES notation for N-(2-cyanopropyl)nitrous amide?
The canonical SMILES for N-(2-cyanopropyl)nitrous amide is CC(C#N)CNN=O.
What is the InChIKey of N-(2-cyanopropyl)nitrous amide?
The InChIKey is HUHZVEQFNQEAKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O/c1-4(2-5)3-6-7-8/h4H,3H2,1H3,(H,6,8).
What are the key properties of N-(2-cyanopropyl)nitrous amide?
N-(2-cyanopropyl)nitrous amide has a molecular weight of 113.12 g/mol, XLogP of 0.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanopropyl)nitrous amide is sourced from PubChem (CID 169495087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).