C13H14N6O4S — CID 169499122
2-(2,3-dimethoxyphenyl)-5-methylsulfonyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 169499122) has the molecular formula C13H14N6O4S and a molecular weight of 350.36 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenyl)-5-methylsulfonyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 2-(2,3-dimethoxyphenyl)-5-methylsulfonyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 169499122 |
| Molecular Formula | C13H14N6O4S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 2-(2,3-dimethoxyphenyl)-5-methylsulfonyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | COc1cccc(-c2nc3nc(S(C)(=O)=O)nc(N)n3n2)c1OC |
| InChI | InChI=1S/C13H14N6O4S/c1-22-8-6-4-5-7(9(8)23-2)10-15-12-17-13(24(3,20)21)16-11(14)19(12)18-10/h4-6H,1-3H3,(H2,14,15,16,17,18) |
| InChIKey | YNOJDRUQEJDUCF-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 134.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |