C12H11N7O4S — CID 169499252
2-(3-methyl-2-nitrophenyl)-5-methylsulfonyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 169499252) has the molecular formula C12H11N7O4S and a molecular weight of 349.33 g/mol. Its IUPAC name is 2-(3-methyl-2-nitrophenyl)-5-methylsulfonyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 2-(3-methyl-2-nitrophenyl)-5-methylsulfonyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 169499252 |
| Molecular Formula | C12H11N7O4S |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 2-(3-methyl-2-nitrophenyl)-5-methylsulfonyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | Cc1cccc(-c2nc3nc(S(C)(=O)=O)nc(N)n3n2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11N7O4S/c1-6-4-3-5-7(8(6)19(20)21)9-14-11-16-12(24(2,22)23)15-10(13)18(11)17-9/h3-5H,1-2H3,(H2,13,14,15,16,17) |
| InChIKey | OEAVPWGPMSPQDX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 159.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|