C12H11N7O2S — CID 169499173
2-(2-methyl-4-nitrophenyl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 169499173) has the molecular formula C12H11N7O2S and a molecular weight of 317.33 g/mol. Its IUPAC name is 2-(2-methyl-4-nitrophenyl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 2-(2-methyl-4-nitrophenyl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 169499173 |
| Molecular Formula | C12H11N7O2S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-(2-methyl-4-nitrophenyl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | CSc1nc(N)n2nc(-c3ccc([N+](=O)[O-])cc3C)nc2n1 |
| InChI | InChI=1S/C12H11N7O2S/c1-6-5-7(19(20)21)3-4-8(6)9-14-11-16-12(22-2)15-10(13)18(11)17-9/h3-5H,1-2H3,(H2,13,14,15,16,17) |
| InChIKey | JXKJHXCQJMQYDZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|