C16H16N6O3 — CID 134430994
N,N,7-trimethyl-2-(2-methyl-4-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxamide (PubChem CID 134430994) has the molecular formula C16H16N6O3 and a molecular weight of 340.34 g/mol. Its IUPAC name is N,N,7-trimethyl-2-(2-methyl-4-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxamide.
| Compound Name | N,N,7-trimethyl-2-(2-methyl-4-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 134430994 |
| Molecular Formula | C16H16N6O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | N,N,7-trimethyl-2-(2-methyl-4-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1-c1nc2nc(C(=O)N(C)C)cc(C)n2n1 |
| InChI | InChI=1S/C16H16N6O3/c1-9-7-11(22(24)25)5-6-12(9)14-18-16-17-13(15(23)20(3)4)8-10(2)21(16)19-14/h5-8H,1-4H3 |
| InChIKey | PQBMCTRARFMVCU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 106.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|