C12H10N2O5 — CID 172904375
N,N-dimethyl-7-nitro-1-oxoisochromene-3-carboxamide (PubChem CID 172904375) has the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. Its IUPAC name is N,N-dimethyl-7-nitro-1-oxoisochromene-3-carboxamide.
| Compound Name | N,N-dimethyl-7-nitro-1-oxoisochromene-3-carboxamide |
|---|---|
| PubChem CID | 172904375 |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | N,N-dimethyl-7-nitro-1-oxoisochromene-3-carboxamide |
| SMILES | CN(C)C(=O)c1cc2ccc([N+](=O)[O-])cc2c(=O)o1 |
| InChI | InChI=1S/C12H10N2O5/c1-13(2)11(15)10-5-7-3-4-8(14(17)18)6-9(7)12(16)19-10/h3-6H,1-2H3 |
| InChIKey | IUHTVVVUYIFXLN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 93.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|