C18H22N4O2S2 — CID 16952488
N-[3-(2-ethoxyethyl)-6-methylsulfanyl-1,3-benzothiazol-2-ylidene]-1,5-dimethylpyrazole-3-carboxamide (PubChem CID 16952488) has the molecular formula C18H22N4O2S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-methylsulfanyl-1,3-benzothiazol-2-ylidene]-1,5-dimethylpyrazole-3-carboxamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-methylsulfanyl-1,3-benzothiazol-2-ylidene]-1,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 16952488 |
| Molecular Formula | C18H22N4O2S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-methylsulfanyl-1,3-benzothiazol-2-ylidene]-1,5-dimethylpyrazole-3-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cc(C)n(C)n2)sc2cc(SC)ccc21 |
| InChI | InChI=1S/C18H22N4O2S2/c1-5-24-9-8-22-15-7-6-13(25-4)11-16(15)26-18(22)19-17(23)14-10-12(2)21(3)20-14/h6-7,10-11H,5,8-9H2,1-4H3/b19-18- |
| InChIKey | NFZOTKJNOKPVDU-HNENSFHCSA-N |
| XLogP | 3.24 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|