C18H16FN3O2S — CID 16954889
2-(4-ethoxyanilino)-N-(4-fluorophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 16954889) has the molecular formula C18H16FN3O2S and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-(4-ethoxyanilino)-N-(4-fluorophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(4-ethoxyanilino)-N-(4-fluorophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16954889 |
| Molecular Formula | C18H16FN3O2S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2-(4-ethoxyanilino)-N-(4-fluorophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCOc1ccc(Nc2nc(C(=O)Nc3ccc(F)cc3)cs2)cc1 |
| InChI | InChI=1S/C18H16FN3O2S/c1-2-24-15-9-7-14(8-10-15)21-18-22-16(11-25-18)17(23)20-13-5-3-12(19)4-6-13/h3-11H,2H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | PGODSGLJBOARNU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |