C22H16BrClN2OS — CID 16958310
2-[2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]pyridin-1-ium-1-yl]-1-phenylethanone bromide (PubChem CID 16958310) has the molecular formula C22H16BrClN2OS and a molecular weight of 471.81 g/mol. Its IUPAC name is 2-[2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]pyridin-1-ium-1-yl]-1-phenylethanone bromide.
| Compound Name | 2-[2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]pyridin-1-ium-1-yl]-1-phenylethanone bromide |
|---|---|
| PubChem CID | 16958310 |
| Molecular Formula | C22H16BrClN2OS |
| Molecular Weight | 471.81 g/mol |
| Exact Mass | 469.99 |
| IUPAC Name | 2-[2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]pyridin-1-ium-1-yl]-1-phenylethanone bromide |
| SMILES | O=C(C[n+]1ccccc1-c1nc(-c2ccc(Cl)cc2)cs1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C22H16ClN2OS.BrH/c23-18-11-9-16(10-12-18)19-15-27-22(24-19)20-8-4-5-13-25(20)14-21(26)17-6-2-1-3-7-17;/h1-13,15H,14H2;1H/q+1;/p-1 |
| InChIKey | JFCJSDSRHVCAFG-UHFFFAOYSA-M |
| XLogP | 2.30 |
| TPSA | 33.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.81 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|