C21H21ClN2O7 — CID 16958856
[1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetate (PubChem CID 16958856) has the molecular formula C21H21ClN2O7 and a molecular weight of 448.86 g/mol. Its IUPAC name is [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetate.
| Compound Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetate |
|---|---|
| PubChem CID | 16958856 |
| Molecular Formula | C21H21ClN2O7 |
| Molecular Weight | 448.86 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetate |
| SMILES | CC(OC(=O)COc1cccc2c1OC(C)(C)C2)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C21H21ClN2O7/c1-12(20(26)23-16-8-7-14(24(27)28)9-15(16)22)30-18(25)11-29-17-6-4-5-13-10-21(2,3)31-19(13)17/h4-9,12H,10-11H2,1-3H3,(H,23,26) |
| InChIKey | PLNOYYXXTDUPNY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.86 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|