C25H24N4O3S — CID 16960570
3-benzyl-4-(4-ethoxyphenyl)-5-[1-(3-nitrophenyl)ethylsulfanyl]-1,2,4-triazole (PubChem CID 16960570) has the molecular formula C25H24N4O3S and a molecular weight of 460.56 g/mol. Its IUPAC name is 3-benzyl-4-(4-ethoxyphenyl)-5-[1-(3-nitrophenyl)ethylsulfanyl]-1,2,4-triazole.
| Compound Name | 3-benzyl-4-(4-ethoxyphenyl)-5-[1-(3-nitrophenyl)ethylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 16960570 |
| Molecular Formula | C25H24N4O3S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 3-benzyl-4-(4-ethoxyphenyl)-5-[1-(3-nitrophenyl)ethylsulfanyl]-1,2,4-triazole |
| SMILES | CCOc1ccc(-n2c(Cc3ccccc3)nnc2SC(C)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C25H24N4O3S/c1-3-32-23-14-12-21(13-15-23)28-24(16-19-8-5-4-6-9-19)26-27-25(28)33-18(2)20-10-7-11-22(17-20)29(30)31/h4-15,17-18H,3,16H2,1-2H3 |
| InChIKey | HJJBKUHUNLLMRT-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|