C21H23BrN4O4 — CID 16961903
1-[2-(2-bromo-4-nitroanilino)-2-oxoethyl]-N-propan-2-yl-3,4-dihydro-2H-quinoline-5-carboxamide (PubChem CID 16961903) has the molecular formula C21H23BrN4O4 and a molecular weight of 475.34 g/mol. Its IUPAC name is 1-[2-(2-bromo-4-nitroanilino)-2-oxoethyl]-N-propan-2-yl-3,4-dihydro-2H-quinoline-5-carboxamide.
| Compound Name | 1-[2-(2-bromo-4-nitroanilino)-2-oxoethyl]-N-propan-2-yl-3,4-dihydro-2H-quinoline-5-carboxamide |
|---|---|
| PubChem CID | 16961903 |
| Molecular Formula | C21H23BrN4O4 |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 1-[2-(2-bromo-4-nitroanilino)-2-oxoethyl]-N-propan-2-yl-3,4-dihydro-2H-quinoline-5-carboxamide |
| SMILES | CC(C)NC(=O)c1cccc2c1CCCN2CC(=O)Nc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C21H23BrN4O4/c1-13(2)23-21(28)16-5-3-7-19-15(16)6-4-10-25(19)12-20(27)24-18-9-8-14(26(29)30)11-17(18)22/h3,5,7-9,11,13H,4,6,10,12H2,1-2H3,(H,23,28)(H,24,27) |
| InChIKey | YJUHLADCOKJQTL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|