C23H27N3O7 — CID 16961982
[2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] 2-(diethylamino)-5-nitrobenzoate (PubChem CID 16961982) has the molecular formula C23H27N3O7 and a molecular weight of 457.48 g/mol. Its IUPAC name is [2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] 2-(diethylamino)-5-nitrobenzoate.
| Compound Name | [2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] 2-(diethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 16961982 |
| Molecular Formula | C23H27N3O7 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | [2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] 2-(diethylamino)-5-nitrobenzoate |
| SMILES | CCN(CC)c1ccc([N+](=O)[O-])cc1C(=O)OCC(=O)NCCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H27N3O7/c1-3-25(4-2)19-7-6-17(26(29)30)14-18(19)23(28)33-15-22(27)24-10-9-16-5-8-20-21(13-16)32-12-11-31-20/h5-8,13-14H,3-4,9-12,15H2,1-2H3,(H,24,27) |
| InChIKey | WYHHVNZZKDMYPO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|