C19H23N3O3 — CID 16965351
methyl 2-[2-(1-cyclopentyl-5-oxopyrrolidin-3-yl)benzimidazol-1-yl]acetate (PubChem CID 16965351) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is methyl 2-[2-(1-cyclopentyl-5-oxopyrrolidin-3-yl)benzimidazol-1-yl]acetate.
| Compound Name | methyl 2-[2-(1-cyclopentyl-5-oxopyrrolidin-3-yl)benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 16965351 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | methyl 2-[2-(1-cyclopentyl-5-oxopyrrolidin-3-yl)benzimidazol-1-yl]acetate |
| SMILES | COC(=O)Cn1c(C2CC(=O)N(C3CCCC3)C2)nc2ccccc21 |
| InChI | InChI=1S/C19H23N3O3/c1-25-18(24)12-22-16-9-5-4-8-15(16)20-19(22)13-10-17(23)21(11-13)14-6-2-3-7-14/h4-5,8-9,13-14H,2-3,6-7,10-12H2,1H3 |
| InChIKey | HVVWAIVUIPUHRT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |