C29H37N3O2 — CID 17005389
1-cyclohexyl-4-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one (PubChem CID 17005389) has the molecular formula C29H37N3O2 and a molecular weight of 459.63 g/mol. Its IUPAC name is 1-cyclohexyl-4-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one.
| Compound Name | 1-cyclohexyl-4-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 17005389 |
| Molecular Formula | C29H37N3O2 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | 1-cyclohexyl-4-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one |
| SMILES | Cc1cc(C)cc(OCCCCn2c(C3CC(=O)N(C4CCCCC4)C3)nc3ccccc32)c1 |
| InChI | InChI=1S/C29H37N3O2/c1-21-16-22(2)18-25(17-21)34-15-9-8-14-31-27-13-7-6-12-26(27)30-29(31)23-19-28(33)32(20-23)24-10-4-3-5-11-24/h6-7,12-13,16-18,23-24H,3-5,8-11,14-15,19-20H2,1-2H3 |
| InChIKey | PYNDSQBBOJQQBS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|