C26H30ClN3O2 — CID 16965198
4-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]-1-cyclopropylpyrrolidin-2-one (PubChem CID 16965198) has the molecular formula C26H30ClN3O2 and a molecular weight of 452.00 g/mol. Its IUPAC name is 4-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]-1-cyclopropylpyrrolidin-2-one.
| Compound Name | 4-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]-1-cyclopropylpyrrolidin-2-one |
|---|---|
| PubChem CID | 16965198 |
| Molecular Formula | C26H30ClN3O2 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 4-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]-1-cyclopropylpyrrolidin-2-one |
| SMILES | Cc1cc(OCCCCn2c(C3CC(=O)N(C4CC4)C3)nc3ccccc32)cc(C)c1Cl |
| InChI | InChI=1S/C26H30ClN3O2/c1-17-13-21(14-18(2)25(17)27)32-12-6-5-11-29-23-8-4-3-7-22(23)28-26(29)19-15-24(31)30(16-19)20-9-10-20/h3-4,7-8,13-14,19-20H,5-6,9-12,15-16H2,1-2H3 |
| InChIKey | ZZLRKJLPYJEKNZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|