C28H35N3O2 — CID 17005386
1-cyclohexyl-4-[1-[4-(3-methylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one (PubChem CID 17005386) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 1-cyclohexyl-4-[1-[4-(3-methylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one.
| Compound Name | 1-cyclohexyl-4-[1-[4-(3-methylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 17005386 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 1-cyclohexyl-4-[1-[4-(3-methylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one |
| SMILES | Cc1cccc(OCCCCn2c(C3CC(=O)N(C4CCCCC4)C3)nc3ccccc32)c1 |
| InChI | InChI=1S/C28H35N3O2/c1-21-10-9-13-24(18-21)33-17-8-7-16-30-26-15-6-5-14-25(26)29-28(30)22-19-27(32)31(20-22)23-11-3-2-4-12-23/h5-6,9-10,13-15,18,22-23H,2-4,7-8,11-12,16-17,19-20H2,1H3 |
| InChIKey | RHRKYNVBZIIIBS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|