C28H34ClN3O2 — CID 17005361
4-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]-1-cyclohexylpyrrolidin-2-one (PubChem CID 17005361) has the molecular formula C28H34ClN3O2 and a molecular weight of 480.05 g/mol. Its IUPAC name is 4-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]-1-cyclohexylpyrrolidin-2-one.
| Compound Name | 4-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]-1-cyclohexylpyrrolidin-2-one |
|---|---|
| PubChem CID | 17005361 |
| Molecular Formula | C28H34ClN3O2 |
| Molecular Weight | 480.05 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 4-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]-1-cyclohexylpyrrolidin-2-one |
| SMILES | Cc1cc(OCCCn2c(C3CC(=O)N(C4CCCCC4)C3)nc3ccccc32)cc(C)c1Cl |
| InChI | InChI=1S/C28H34ClN3O2/c1-19-15-23(16-20(2)27(19)29)34-14-8-13-31-25-12-7-6-11-24(25)30-28(31)21-17-26(33)32(18-21)22-9-4-3-5-10-22/h6-7,11-12,15-16,21-22H,3-5,8-10,13-14,17-18H2,1-2H3 |
| InChIKey | BEBHXRRWLFISOL-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.05 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|