C30H31ClFN3O2 — CID 17005685
4-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]-1-[(4-fluorophenyl)methyl]pyrrolidin-2-one (PubChem CID 17005685) has the molecular formula C30H31ClFN3O2 and a molecular weight of 520.05 g/mol. Its IUPAC name is 4-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]-1-[(4-fluorophenyl)methyl]pyrrolidin-2-one.
| Compound Name | 4-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]-1-[(4-fluorophenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 17005685 |
| Molecular Formula | C30H31ClFN3O2 |
| Molecular Weight | 520.05 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 4-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]-1-[(4-fluorophenyl)methyl]pyrrolidin-2-one |
| SMILES | Cc1cc(OCCCCn2c(C3CC(=O)N(Cc4ccc(F)cc4)C3)nc3ccccc32)cc(C)c1Cl |
| InChI | InChI=1S/C30H31ClFN3O2/c1-20-15-25(16-21(2)29(20)31)37-14-6-5-13-35-27-8-4-3-7-26(27)33-30(35)23-17-28(36)34(19-23)18-22-9-11-24(32)12-10-22/h3-4,7-12,15-16,23H,5-6,13-14,17-19H2,1-2H3 |
| InChIKey | QGPBJHKNGGEYEK-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.05 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|