C30H33N3O4 — CID 19242855
4-[1-[4-(4-methoxyphenoxy)butyl]benzimidazol-2-yl]-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one (PubChem CID 19242855) has the molecular formula C30H33N3O4 and a molecular weight of 499.61 g/mol. Its IUPAC name is 4-[1-[4-(4-methoxyphenoxy)butyl]benzimidazol-2-yl]-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one.
| Compound Name | 4-[1-[4-(4-methoxyphenoxy)butyl]benzimidazol-2-yl]-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 19242855 |
| Molecular Formula | C30H33N3O4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | 4-[1-[4-(4-methoxyphenoxy)butyl]benzimidazol-2-yl]-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one |
| SMILES | COc1ccc(CN2CC(c3nc4ccccc4n3CCCCOc3ccc(OC)cc3)CC2=O)cc1 |
| InChI | InChI=1S/C30H33N3O4/c1-35-24-11-9-22(10-12-24)20-32-21-23(19-29(32)34)30-31-27-7-3-4-8-28(27)33(30)17-5-6-18-37-26-15-13-25(36-2)14-16-26/h3-4,7-16,23H,5-6,17-21H2,1-2H3 |
| InChIKey | CUGWEJHINPXQQL-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|