C29H39N3O2 — CID 19242754
4-(1-decylbenzimidazol-2-yl)-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one (PubChem CID 19242754) has the molecular formula C29H39N3O2 and a molecular weight of 461.65 g/mol. Its IUPAC name is 4-(1-decylbenzimidazol-2-yl)-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one.
| Compound Name | 4-(1-decylbenzimidazol-2-yl)-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 19242754 |
| Molecular Formula | C29H39N3O2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | 4-(1-decylbenzimidazol-2-yl)-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one |
| SMILES | CCCCCCCCCCn1c(C2CC(=O)N(Cc3ccc(OC)cc3)C2)nc2ccccc21 |
| InChI | InChI=1S/C29H39N3O2/c1-3-4-5-6-7-8-9-12-19-32-27-14-11-10-13-26(27)30-29(32)24-20-28(33)31(22-24)21-23-15-17-25(34-2)18-16-23/h10-11,13-18,24H,3-9,12,19-22H2,1-2H3 |
| InChIKey | UTFLJPBHEWGTSZ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|