C23H20N4O2 — CID 16965517
N-[1-(1-phenacylbenzimidazol-2-yl)ethyl]pyridine-4-carboxamide (PubChem CID 16965517) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is N-[1-(1-phenacylbenzimidazol-2-yl)ethyl]pyridine-4-carboxamide.
| Compound Name | N-[1-(1-phenacylbenzimidazol-2-yl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 16965517 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[1-(1-phenacylbenzimidazol-2-yl)ethyl]pyridine-4-carboxamide |
| SMILES | CC(NC(=O)c1ccncc1)c1nc2ccccc2n1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H20N4O2/c1-16(25-23(29)18-11-13-24-14-12-18)22-26-19-9-5-6-10-20(19)27(22)15-21(28)17-7-3-2-4-8-17/h2-14,16H,15H2,1H3,(H,25,29) |
| InChIKey | ZVNPCWJVPRHRFM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |