C23H25N5O2 — CID 16965496
N-[1-[1-[2-[bis(prop-2-enyl)amino]-2-oxoethyl]benzimidazol-2-yl]ethyl]pyridine-4-carboxamide (PubChem CID 16965496) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is N-[1-[1-[2-[bis(prop-2-enyl)amino]-2-oxoethyl]benzimidazol-2-yl]ethyl]pyridine-4-carboxamide.
| Compound Name | N-[1-[1-[2-[bis(prop-2-enyl)amino]-2-oxoethyl]benzimidazol-2-yl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 16965496 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | N-[1-[1-[2-[bis(prop-2-enyl)amino]-2-oxoethyl]benzimidazol-2-yl]ethyl]pyridine-4-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)Cn1c(C(C)NC(=O)c2ccncc2)nc2ccccc21 |
| InChI | InChI=1S/C23H25N5O2/c1-4-14-27(15-5-2)21(29)16-28-20-9-7-6-8-19(20)26-22(28)17(3)25-23(30)18-10-12-24-13-11-18/h4-13,17H,1-2,14-16H2,3H3,(H,25,30) |
| InChIKey | ULQZDBUMUNVPOU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|