C23H21ClN4O2 — CID 16965753
N-[[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]methyl]-N-methylpyridine-4-carboxamide (PubChem CID 16965753) has the molecular formula C23H21ClN4O2 and a molecular weight of 420.90 g/mol. Its IUPAC name is N-[[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]methyl]-N-methylpyridine-4-carboxamide.
| Compound Name | N-[[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]methyl]-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 16965753 |
| Molecular Formula | C23H21ClN4O2 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]methyl]-N-methylpyridine-4-carboxamide |
| SMILES | CN(Cc1nc2ccccc2n1CCOc1ccc(Cl)cc1)C(=O)c1ccncc1 |
| InChI | InChI=1S/C23H21ClN4O2/c1-27(23(29)17-10-12-25-13-11-17)16-22-26-20-4-2-3-5-21(20)28(22)14-15-30-19-8-6-18(24)7-9-19/h2-13H,14-16H2,1H3 |
| InChIKey | MMLWKQPIBPUSLY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |