C29H34N4O2 — CID 16964193
N-[[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]methyl]-N-methylpyridine-3-carboxamide (PubChem CID 16964193) has the molecular formula C29H34N4O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is N-[[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]methyl]-N-methylpyridine-3-carboxamide.
| Compound Name | N-[[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]methyl]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 16964193 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | N-[[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]methyl]-N-methylpyridine-3-carboxamide |
| SMILES | CN(Cc1nc2ccccc2n1CCCCOc1ccc(C(C)(C)C)cc1)C(=O)c1cccnc1 |
| InChI | InChI=1S/C29H34N4O2/c1-29(2,3)23-13-15-24(16-14-23)35-19-8-7-18-33-26-12-6-5-11-25(26)31-27(33)21-32(4)28(34)22-10-9-17-30-20-22/h5-6,9-17,20H,7-8,18-19,21H2,1-4H3 |
| InChIKey | PLZFXSMMLCJHHS-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|