C24H30ClN3O2 — CID 16969422
N-[1-[1-[4-(4-chlorophenoxy)butyl]benzimidazol-2-yl]ethyl]-2,2-dimethylpropanamide (PubChem CID 16969422) has the molecular formula C24H30ClN3O2 and a molecular weight of 427.98 g/mol. Its IUPAC name is N-[1-[1-[4-(4-chlorophenoxy)butyl]benzimidazol-2-yl]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[1-[1-[4-(4-chlorophenoxy)butyl]benzimidazol-2-yl]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 16969422 |
| Molecular Formula | C24H30ClN3O2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | N-[1-[1-[4-(4-chlorophenoxy)butyl]benzimidazol-2-yl]ethyl]-2,2-dimethylpropanamide |
| SMILES | CC(NC(=O)C(C)(C)C)c1nc2ccccc2n1CCCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H30ClN3O2/c1-17(26-23(29)24(2,3)4)22-27-20-9-5-6-10-21(20)28(22)15-7-8-16-30-19-13-11-18(25)12-14-19/h5-6,9-14,17H,7-8,15-16H2,1-4H3,(H,26,29) |
| InChIKey | FPENALMVSPUHFN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|