C30H34ClN3O2 — CID 17010530
N-[1-[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3-chlorobenzamide (PubChem CID 17010530) has the molecular formula C30H34ClN3O2 and a molecular weight of 504.07 g/mol. Its IUPAC name is N-[1-[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3-chlorobenzamide.
| Compound Name | N-[1-[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 17010530 |
| Molecular Formula | C30H34ClN3O2 |
| Molecular Weight | 504.07 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | N-[1-[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3-chlorobenzamide |
| SMILES | CC(NC(=O)c1cccc(Cl)c1)c1nc2ccccc2n1CCCCOc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H34ClN3O2/c1-21(32-29(35)22-10-9-11-24(31)20-22)28-33-26-12-5-6-13-27(26)34(28)18-7-8-19-36-25-16-14-23(15-17-25)30(2,3)4/h5-6,9-17,20-21H,7-8,18-19H2,1-4H3,(H,32,35) |
| InChIKey | PSDSWGSXXVADHN-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.07 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|