C29H33N3O3 — CID 17010157
N-[1-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]ethyl]-3-methoxybenzamide (PubChem CID 17010157) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is N-[1-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]ethyl]-3-methoxybenzamide.
| Compound Name | N-[1-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 17010157 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | N-[1-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]ethyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NC(C)c2nc3ccccc3n2CCOc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C29H33N3O3/c1-20(30-28(33)21-9-8-10-24(19-21)34-5)27-31-25-11-6-7-12-26(25)32(27)17-18-35-23-15-13-22(14-16-23)29(2,3)4/h6-16,19-20H,17-18H2,1-5H3,(H,30,33) |
| InChIKey | CVGQRNVJNGBPBH-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |