C26H33N3O3 — CID 16975415
N-[2-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]oxolane-2-carboxamide (PubChem CID 16975415) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is N-[2-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]oxolane-2-carboxamide.
| Compound Name | N-[2-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 16975415 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | N-[2-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]oxolane-2-carboxamide |
| SMILES | Cc1ccc(OCCCCn2c(CCNC(=O)C3CCCO3)nc3ccccc32)cc1C |
| InChI | InChI=1S/C26H33N3O3/c1-19-11-12-21(18-20(19)2)31-16-6-5-15-29-23-9-4-3-8-22(23)28-25(29)13-14-27-26(30)24-10-7-17-32-24/h3-4,8-9,11-12,18,24H,5-7,10,13-17H2,1-2H3,(H,27,30) |
| InChIKey | PYBRECCNZULMKN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|