C28H35N3O4 — CID 16975412
N-[2-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]ethyl]oxolane-2-carboxamide (PubChem CID 16975412) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is N-[2-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]ethyl]oxolane-2-carboxamide.
| Compound Name | N-[2-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 16975412 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | N-[2-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]ethyl]oxolane-2-carboxamide |
| SMILES | C/C=C/c1ccc(OCCCCn2c(CCNC(=O)C3CCCO3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C28H35N3O4/c1-3-9-21-13-14-24(26(20-21)33-2)34-18-7-6-17-31-23-11-5-4-10-22(23)30-27(31)15-16-29-28(32)25-12-8-19-35-25/h3-5,9-11,13-14,20,25H,6-8,12,15-19H2,1-2H3,(H,29,32)/b9-3+ |
| InChIKey | UOMOVEVVAHAUKP-YCRREMRBSA-N |
| XLogP | 4.77 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|