C27H36N4O2 — CID 16976021
N-[2-[1-[2-[di(butan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]ethyl]-2-methylbenzamide (PubChem CID 16976021) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is N-[2-[1-[2-[di(butan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]ethyl]-2-methylbenzamide.
| Compound Name | N-[2-[1-[2-[di(butan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]ethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 16976021 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | N-[2-[1-[2-[di(butan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]ethyl]-2-methylbenzamide |
| SMILES | CCC(C)N(C(=O)Cn1c(CCNC(=O)c2ccccc2C)nc2ccccc21)C(C)CC |
| InChI | InChI=1S/C27H36N4O2/c1-6-20(4)31(21(5)7-2)26(32)18-30-24-15-11-10-14-23(24)29-25(30)16-17-28-27(33)22-13-9-8-12-19(22)3/h8-15,20-21H,6-7,16-18H2,1-5H3,(H,28,33) |
| InChIKey | UMNFUHHJKADAKR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |