C29H30ClN3O2 — CID 16978006
3-chloro-N-[2-[1-[4-(2-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 16978006) has the molecular formula C29H30ClN3O2 and a molecular weight of 488.03 g/mol. Its IUPAC name is 3-chloro-N-[2-[1-[4-(2-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 3-chloro-N-[2-[1-[4-(2-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16978006 |
| Molecular Formula | C29H30ClN3O2 |
| Molecular Weight | 488.03 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 3-chloro-N-[2-[1-[4-(2-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | C=CCc1ccccc1OCCCCn1c(CCNC(=O)c2cccc(Cl)c2)nc2ccccc21 |
| InChI | InChI=1S/C29H30ClN3O2/c1-2-10-22-11-3-6-16-27(22)35-20-8-7-19-33-26-15-5-4-14-25(26)32-28(33)17-18-31-29(34)23-12-9-13-24(30)21-23/h2-6,9,11-16,21H,1,7-8,10,17-20H2,(H,31,34) |
| InChIKey | RJYZVQWRIJFGLH-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.03 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|