C27H28ClN3O2 — CID 16977974
3-chloro-N-[2-[1-[3-(2,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 16977974) has the molecular formula C27H28ClN3O2 and a molecular weight of 461.99 g/mol. Its IUPAC name is 3-chloro-N-[2-[1-[3-(2,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 3-chloro-N-[2-[1-[3-(2,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16977974 |
| Molecular Formula | C27H28ClN3O2 |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 3-chloro-N-[2-[1-[3-(2,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | Cc1ccc(C)c(OCCCn2c(CCNC(=O)c3cccc(Cl)c3)nc3ccccc32)c1 |
| InChI | InChI=1S/C27H28ClN3O2/c1-19-11-12-20(2)25(17-19)33-16-6-15-31-24-10-4-3-9-23(24)30-26(31)13-14-29-27(32)21-7-5-8-22(28)18-21/h3-5,7-12,17-18H,6,13-16H2,1-2H3,(H,29,32) |
| InChIKey | IBBMVONYZGKWNT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|