C26H33N3O2 — CID 16981794
N-[3-[1-[(2,3,5,6-tetramethylphenyl)methyl]benzimidazol-2-yl]propyl]oxolane-2-carboxamide (PubChem CID 16981794) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-[3-[1-[(2,3,5,6-tetramethylphenyl)methyl]benzimidazol-2-yl]propyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[1-[(2,3,5,6-tetramethylphenyl)methyl]benzimidazol-2-yl]propyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 16981794 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | N-[3-[1-[(2,3,5,6-tetramethylphenyl)methyl]benzimidazol-2-yl]propyl]oxolane-2-carboxamide |
| SMILES | Cc1cc(C)c(C)c(Cn2c(CCCNC(=O)C3CCCO3)nc3ccccc32)c1C |
| InChI | InChI=1S/C26H33N3O2/c1-17-15-18(2)20(4)21(19(17)3)16-29-23-10-6-5-9-22(23)28-25(29)12-7-13-27-26(30)24-11-8-14-31-24/h5-6,9-10,15,24H,7-8,11-14,16H2,1-4H3,(H,27,30) |
| InChIKey | AYESUCFPGQTAQZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|