C25H30N4O3 — CID 17031223
N-[3-[1-[2-(2,5-dimethylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]oxolane-2-carboxamide (PubChem CID 17031223) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[3-[1-[2-(2,5-dimethylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[1-[2-(2,5-dimethylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 17031223 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | N-[3-[1-[2-(2,5-dimethylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]oxolane-2-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)Cn2c(CCCNC(=O)C3CCCO3)nc3ccccc32)c1 |
| InChI | InChI=1S/C25H30N4O3/c1-17-11-12-18(2)20(15-17)28-24(30)16-29-21-8-4-3-7-19(21)27-23(29)10-5-13-26-25(31)22-9-6-14-32-22/h3-4,7-8,11-12,15,22H,5-6,9-10,13-14,16H2,1-2H3,(H,26,31)(H,28,30) |
| InChIKey | KBYIPBWDXILIRN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|