C20H28N4O3 — CID 17030558
N-[2-[1-[2-(tert-butylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]oxolane-2-carboxamide (PubChem CID 17030558) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[2-[1-[2-(tert-butylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]oxolane-2-carboxamide.
| Compound Name | N-[2-[1-[2-(tert-butylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 17030558 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-[2-[1-[2-(tert-butylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]oxolane-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)Cn1c(CCNC(=O)C2CCCO2)nc2ccccc21 |
| InChI | InChI=1S/C20H28N4O3/c1-20(2,3)23-18(25)13-24-15-8-5-4-7-14(15)22-17(24)10-11-21-19(26)16-9-6-12-27-16/h4-5,7-8,16H,6,9-13H2,1-3H3,(H,21,26)(H,23,25) |
| InChIKey | UVJAPXMDLINYHF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |