C24H30N4O2 — CID 17031125
N-[3-[1-[2-(2,5-dimethylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]butanamide (PubChem CID 17031125) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-[3-[1-[2-(2,5-dimethylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]butanamide.
| Compound Name | N-[3-[1-[2-(2,5-dimethylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]butanamide |
|---|---|
| PubChem CID | 17031125 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | N-[3-[1-[2-(2,5-dimethylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]butanamide |
| SMILES | CCCC(=O)NCCCc1nc2ccccc2n1CC(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C24H30N4O2/c1-4-8-23(29)25-14-7-11-22-26-19-9-5-6-10-21(19)28(22)16-24(30)27-20-15-17(2)12-13-18(20)3/h5-6,9-10,12-13,15H,4,7-8,11,14,16H2,1-3H3,(H,25,29)(H,27,30) |
| InChIKey | VQZIHOFXQRDVDM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|