C30H35N3O2 — CID 16982559
2,4-dimethyl-N-[3-[1-[2-(2-propan-2-ylphenoxy)ethyl]benzimidazol-2-yl]propyl]benzamide (PubChem CID 16982559) has the molecular formula C30H35N3O2 and a molecular weight of 469.63 g/mol. Its IUPAC name is 2,4-dimethyl-N-[3-[1-[2-(2-propan-2-ylphenoxy)ethyl]benzimidazol-2-yl]propyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[3-[1-[2-(2-propan-2-ylphenoxy)ethyl]benzimidazol-2-yl]propyl]benzamide |
|---|---|
| PubChem CID | 16982559 |
| Molecular Formula | C30H35N3O2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 2,4-dimethyl-N-[3-[1-[2-(2-propan-2-ylphenoxy)ethyl]benzimidazol-2-yl]propyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCCCc2nc3ccccc3n2CCOc2ccccc2C(C)C)c(C)c1 |
| InChI | InChI=1S/C30H35N3O2/c1-21(2)24-10-5-8-13-28(24)35-19-18-33-27-12-7-6-11-26(27)32-29(33)14-9-17-31-30(34)25-16-15-22(3)20-23(25)4/h5-8,10-13,15-16,20-21H,9,14,17-19H2,1-4H3,(H,31,34) |
| InChIKey | CNWCEVODNGGRDX-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|