C30H33N3O2 — CID 16982560
2,4-dimethyl-N-[3-[1-[2-(2-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]propyl]benzamide (PubChem CID 16982560) has the molecular formula C30H33N3O2 and a molecular weight of 467.61 g/mol. Its IUPAC name is 2,4-dimethyl-N-[3-[1-[2-(2-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]propyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[3-[1-[2-(2-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]propyl]benzamide |
|---|---|
| PubChem CID | 16982560 |
| Molecular Formula | C30H33N3O2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 2,4-dimethyl-N-[3-[1-[2-(2-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]propyl]benzamide |
| SMILES | C=CCc1ccccc1OCCn1c(CCCNC(=O)c2ccc(C)cc2C)nc2ccccc21 |
| InChI | InChI=1S/C30H33N3O2/c1-4-10-24-11-5-8-14-28(24)35-20-19-33-27-13-7-6-12-26(27)32-29(33)15-9-18-31-30(34)25-17-16-22(2)21-23(25)3/h4-8,11-14,16-17,21H,1,9-10,15,18-20H2,2-3H3,(H,31,34) |
| InChIKey | IXAKBNSRTIAUFD-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|