C31H35N3O2 — CID 16991917
4-methyl-N-[5-[1-[2-(2-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16991917) has the molecular formula C31H35N3O2 and a molecular weight of 481.64 g/mol. Its IUPAC name is 4-methyl-N-[5-[1-[2-(2-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 4-methyl-N-[5-[1-[2-(2-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16991917 |
| Molecular Formula | C31H35N3O2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | 4-methyl-N-[5-[1-[2-(2-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | C=CCc1ccccc1OCCn1c(CCCCCNC(=O)c2ccc(C)cc2)nc2ccccc21 |
| InChI | InChI=1S/C31H35N3O2/c1-3-11-25-12-6-9-15-29(25)36-23-22-34-28-14-8-7-13-27(28)33-30(34)16-5-4-10-21-32-31(35)26-19-17-24(2)18-20-26/h3,6-9,12-15,17-20H,1,4-5,10-11,16,21-23H2,2H3,(H,32,35) |
| InChIKey | UIFRNGOULNRINI-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|