C25H24ClN3O — CID 16984574
4-chloro-N-[3-[1-(1-phenylethyl)benzimidazol-2-yl]propyl]benzamide (PubChem CID 16984574) has the molecular formula C25H24ClN3O and a molecular weight of 417.94 g/mol. Its IUPAC name is 4-chloro-N-[3-[1-(1-phenylethyl)benzimidazol-2-yl]propyl]benzamide.
| Compound Name | 4-chloro-N-[3-[1-(1-phenylethyl)benzimidazol-2-yl]propyl]benzamide |
|---|---|
| PubChem CID | 16984574 |
| Molecular Formula | C25H24ClN3O |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 4-chloro-N-[3-[1-(1-phenylethyl)benzimidazol-2-yl]propyl]benzamide |
| SMILES | CC(c1ccccc1)n1c(CCCNC(=O)c2ccc(Cl)cc2)nc2ccccc21 |
| InChI | InChI=1S/C25H24ClN3O/c1-18(19-8-3-2-4-9-19)29-23-11-6-5-10-22(23)28-24(29)12-7-17-27-25(30)20-13-15-21(26)16-14-20/h2-6,8-11,13-16,18H,7,12,17H2,1H3,(H,27,30) |
| InChIKey | WFFVUILIWJPAAK-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|