C26H26ClN3O2 — CID 16986394
2-(4-chlorophenoxy)-N-[3-[1-(1-phenylethyl)benzimidazol-2-yl]propyl]acetamide (PubChem CID 16986394) has the molecular formula C26H26ClN3O2 and a molecular weight of 447.97 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[3-[1-(1-phenylethyl)benzimidazol-2-yl]propyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[3-[1-(1-phenylethyl)benzimidazol-2-yl]propyl]acetamide |
|---|---|
| PubChem CID | 16986394 |
| Molecular Formula | C26H26ClN3O2 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[3-[1-(1-phenylethyl)benzimidazol-2-yl]propyl]acetamide |
| SMILES | CC(c1ccccc1)n1c(CCCNC(=O)COc2ccc(Cl)cc2)nc2ccccc21 |
| InChI | InChI=1S/C26H26ClN3O2/c1-19(20-8-3-2-4-9-20)30-24-11-6-5-10-23(24)29-25(30)12-7-17-28-26(31)18-32-22-15-13-21(27)14-16-22/h2-6,8-11,13-16,19H,7,12,17-18H2,1H3,(H,28,31) |
| InChIKey | ROKSGULXZUTIGS-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|