C30H33N3O — CID 16986158
(Z)-N-[3-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]propyl]-3-phenylprop-2-enamide (PubChem CID 16986158) has the molecular formula C30H33N3O and a molecular weight of 451.61 g/mol. Its IUPAC name is (Z)-N-[3-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]propyl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-[3-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]propyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 16986158 |
| Molecular Formula | C30H33N3O |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | (Z)-N-[3-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]propyl]-3-phenylprop-2-enamide |
| SMILES | CCC(C)c1ccc(Cn2c(CCCNC(=O)/C=C\c3ccccc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C30H33N3O/c1-3-23(2)26-18-15-25(16-19-26)22-33-28-13-8-7-12-27(28)32-29(33)14-9-21-31-30(34)20-17-24-10-5-4-6-11-24/h4-8,10-13,15-20,23H,3,9,14,21-22H2,1-2H3,(H,31,34)/b20-17- |
| InChIKey | RJBWZFGLJWZPOW-JZJYNLBNSA-N |
| XLogP | 6.36 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|