C24H24N2O2 — CID 16987578
2-(2,4-dimethylphenyl)-1-[2-(4-methoxyphenoxy)ethyl]benzimidazole (PubChem CID 16987578) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-1-[2-(4-methoxyphenoxy)ethyl]benzimidazole.
| Compound Name | 2-(2,4-dimethylphenyl)-1-[2-(4-methoxyphenoxy)ethyl]benzimidazole |
|---|---|
| PubChem CID | 16987578 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-1-[2-(4-methoxyphenoxy)ethyl]benzimidazole |
| SMILES | COc1ccc(OCCn2c(-c3ccc(C)cc3C)nc3ccccc32)cc1 |
| InChI | InChI=1S/C24H24N2O2/c1-17-8-13-21(18(2)16-17)24-25-22-6-4-5-7-23(22)26(24)14-15-28-20-11-9-19(27-3)10-12-20/h4-13,16H,14-15H2,1-3H3 |
| InChIKey | VMARBBVKNXAOHQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |