C27H28N2O2 — CID 16987566
2-(2,4-dimethylphenyl)-1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazole (PubChem CID 16987566) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazole.
| Compound Name | 2-(2,4-dimethylphenyl)-1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazole |
|---|---|
| PubChem CID | 16987566 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazole |
| SMILES | C=CCc1ccc(OCCn2c(-c3ccc(C)cc3C)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C27H28N2O2/c1-5-8-21-12-14-25(26(18-21)30-4)31-16-15-29-24-10-7-6-9-23(24)28-27(29)22-13-11-19(2)17-20(22)3/h5-7,9-14,17-18H,1,8,15-16H2,2-4H3 |
| InChIKey | XOCRMXIUMAEMPA-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|