C25H30N2O2 — CID 16996609
2-cyclohexyl-1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazole (PubChem CID 16996609) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 2-cyclohexyl-1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazole.
| Compound Name | 2-cyclohexyl-1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazole |
|---|---|
| PubChem CID | 16996609 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 2-cyclohexyl-1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazole |
| SMILES | C=CCc1ccc(OCCn2c(C3CCCCC3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C25H30N2O2/c1-3-9-19-14-15-23(24(18-19)28-2)29-17-16-27-22-13-8-7-12-21(22)26-25(27)20-10-5-4-6-11-20/h3,7-8,12-15,18,20H,1,4-6,9-11,16-17H2,2H3 |
| InChIKey | FLRYLLRLDLSOIA-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|