C29H32N2O2 — CID 16987621
2-(2,4-dimethylphenyl)-1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazole (PubChem CID 16987621) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazole.
| Compound Name | 2-(2,4-dimethylphenyl)-1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazole |
|---|---|
| PubChem CID | 16987621 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazole |
| SMILES | C/C=C/c1ccc(OCCCCn2c(-c3ccc(C)cc3C)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C29H32N2O2/c1-5-10-23-14-16-27(28(20-23)32-4)33-18-9-8-17-31-26-12-7-6-11-25(26)30-29(31)24-15-13-21(2)19-22(24)3/h5-7,10-16,19-20H,8-9,17-18H2,1-4H3/b10-5+ |
| InChIKey | XLGIXFBWNSMGLQ-BJMVGYQFSA-N |
| XLogP | 7.22 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|