C23H26N2O2 — CID 16996695
2-cyclopropyl-1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazole (PubChem CID 16996695) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-cyclopropyl-1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazole.
| Compound Name | 2-cyclopropyl-1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazole |
|---|---|
| PubChem CID | 16996695 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 2-cyclopropyl-1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazole |
| SMILES | C/C=C/c1ccc(OCCCn2c(C3CC3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C23H26N2O2/c1-3-7-17-10-13-21(22(16-17)26-2)27-15-6-14-25-20-9-5-4-8-19(20)24-23(25)18-11-12-18/h3-5,7-10,13,16,18H,6,11-12,14-15H2,1-2H3/b7-3+ |
| InChIKey | SXSNQODWXBDQFT-XVNBXDOJSA-N |
| XLogP | 5.42 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|