C24H24N2O3 — CID 17000188
2-(furan-2-yl)-1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazole (PubChem CID 17000188) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-(furan-2-yl)-1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazole.
| Compound Name | 2-(furan-2-yl)-1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazole |
|---|---|
| PubChem CID | 17000188 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-(furan-2-yl)-1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazole |
| SMILES | C/C=C/c1ccc(OCCCn2c(-c3ccco3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C24H24N2O3/c1-3-8-18-12-13-21(23(17-18)27-2)28-16-7-14-26-20-10-5-4-9-19(20)25-24(26)22-11-6-15-29-22/h3-6,8-13,15,17H,7,14,16H2,1-2H3/b8-3+ |
| InChIKey | CSUPFTQDLWPVDZ-FPYGCLRLSA-N |
| XLogP | 5.81 |
| TPSA | 49.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|